C21H21BrN6O2S — CID 89151156
9-[2-[(3S,5R,8S)-1-azatricyclo[3.3.0.02,8]octan-3-yl]ethyl]-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine (PubChem CID 89151156) has the molecular formula C21H21BrN6O2S and a molecular weight of 501.41 g/mol. Its IUPAC name is 9-[2-[(3S,5R,8S)-1-azatricyclo[3.3.0.02,8]octan-3-yl]ethyl]-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine.
| Compound Name | 9-[2-[(3S,5R,8S)-1-azatricyclo[3.3.0.02,8]octan-3-yl]ethyl]-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
|---|---|
| PubChem CID | 89151156 |
| Molecular Formula | C21H21BrN6O2S |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | 9-[2-[(3S,5R,8S)-1-azatricyclo[3.3.0.02,8]octan-3-yl]ethyl]-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-6-amine |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1Br)OCO3)n2CC[C@H]1C[C@H]2CC[C@H]3C1N23 |
| InChI | InChI=1S/C21H21BrN6O2S/c22-12-6-14-15(30-9-29-14)7-16(12)31-21-26-17-19(23)24-8-25-20(17)27(21)4-3-10-5-11-1-2-13-18(10)28(11)13/h6-8,10-11,13,18H,1-5,9H2,(H2,23,24,25)/t10-,11+,13-,18?,28?/m0/s1 |
| InChIKey | RKTBWBACXJKYMZ-RJBDVIBLSA-N |
| XLogP | 3.68 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|