C20H23BrN6O5S — CID 25070189
6-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethoxy]-N-hydroxyhexanamide (PubChem CID 25070189) has the molecular formula C20H23BrN6O5S and a molecular weight of 539.41 g/mol. Its IUPAC name is 6-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethoxy]-N-hydroxyhexanamide.
| Compound Name | 6-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethoxy]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 25070189 |
| Molecular Formula | C20H23BrN6O5S |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 6-[2-[6-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethoxy]-N-hydroxyhexanamide |
| SMILES | Nc1ncnc2c1nc(Sc1cc3c(cc1Br)OCO3)n2CCOCCCCCC(=O)NO |
| InChI | InChI=1S/C20H23BrN6O5S/c21-12-8-13-14(32-11-31-13)9-15(12)33-20-25-17-18(22)23-10-24-19(17)27(20)5-7-30-6-3-1-2-4-16(28)26-29/h8-10,29H,1-7,11H2,(H,26,28)(H2,22,23,24) |
| InChIKey | ZJLHLNDVMNYNIX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 146.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|