C24H32N6O2S — CID 122667986
8-[(7-cyclopentyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine (PubChem CID 122667986) has the molecular formula C24H32N6O2S and a molecular weight of 468.63 g/mol. Its IUPAC name is 8-[(7-cyclopentyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine.
| Compound Name | 8-[(7-cyclopentyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine |
|---|---|
| PubChem CID | 122667986 |
| Molecular Formula | C24H32N6O2S |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 8-[(7-cyclopentyl-2,3-dihydro-1,4-benzodioxin-6-yl)sulfanyl]-9-[2-(2-methylpropylamino)ethyl]purin-6-amine |
| SMILES | CC(C)CNCCn1c(Sc2cc3c(cc2C2CCCC2)OCCO3)nc2c(N)ncnc21 |
| InChI | InChI=1S/C24H32N6O2S/c1-15(2)13-26-7-8-30-23-21(22(25)27-14-28-23)29-24(30)33-20-12-19-18(31-9-10-32-19)11-17(20)16-5-3-4-6-16/h11-12,14-16,26H,3-10,13H2,1-2H3,(H2,25,27,28) |
| InChIKey | AFFIOSBWFOGIAE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|