C23H24N6O3S — CID 88852923
1-[3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone (PubChem CID 88852923) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is 1-[3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 88852923 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1-[3-[2-[6-amino-8-[(6-ethynyl-1,3-benzodioxol-5-yl)sulfanyl]purin-9-yl]ethyl]piperidin-1-yl]ethanone |
| SMILES | C#Cc1cc2c(cc1Sc1nc3c(N)ncnc3n1CCC1CCCN(C(C)=O)C1)OCO2 |
| InChI | InChI=1S/C23H24N6O3S/c1-3-16-9-17-18(32-13-31-17)10-19(16)33-23-27-20-21(24)25-12-26-22(20)29(23)8-6-15-5-4-7-28(11-15)14(2)30/h1,9-10,12,15H,4-8,11,13H2,2H3,(H2,24,25,26) |
| InChIKey | NJSNBGHETWPSCN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|