C26H28N5O9P — CID 10054049
[4-[[(4-acetyloxyphenyl)methoxy-[2-(6-aminopurin-9-yl)oxyethoxymethyl]phosphoryl]oxymethyl]phenyl] acetate (PubChem CID 10054049) has the molecular formula C26H28N5O9P and a molecular weight of 585.51 g/mol. Its IUPAC name is [4-[[(4-acetyloxyphenyl)methoxy-[2-(6-aminopurin-9-yl)oxyethoxymethyl]phosphoryl]oxymethyl]phenyl] acetate.
| Compound Name | [4-[[(4-acetyloxyphenyl)methoxy-[2-(6-aminopurin-9-yl)oxyethoxymethyl]phosphoryl]oxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 10054049 |
| Molecular Formula | C26H28N5O9P |
| Molecular Weight | 585.51 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | [4-[[(4-acetyloxyphenyl)methoxy-[2-(6-aminopurin-9-yl)oxyethoxymethyl]phosphoryl]oxymethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COP(=O)(COCCOn2cnc3c(N)ncnc32)OCc2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H28N5O9P/c1-18(32)39-22-7-3-20(4-8-22)13-37-41(34,38-14-21-5-9-23(10-6-21)40-19(2)33)17-35-11-12-36-31-16-30-24-25(27)28-15-29-26(24)31/h3-10,15-16H,11-14,17H2,1-2H3,(H2,27,28,29) |
| InChIKey | NPLPGSFVRSTYLG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 176.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|