C29H31N5O4 — CID 131719616
[4-[(4-acetyloxyphenyl)-cyclohexylidenemethyl]phenyl] acetate;9-methylpurin-6-amine (PubChem CID 131719616) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is [4-[(4-acetyloxyphenyl)-cyclohexylidenemethyl]phenyl] acetate;9-methylpurin-6-amine.
| Compound Name | [4-[(4-acetyloxyphenyl)-cyclohexylidenemethyl]phenyl] acetate;9-methylpurin-6-amine |
|---|---|
| PubChem CID | 131719616 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | [4-[(4-acetyloxyphenyl)-cyclohexylidenemethyl]phenyl] acetate;9-methylpurin-6-amine |
| SMILES | CC(=O)Oc1ccc(C(=C2CCCCC2)c2ccc(OC(C)=O)cc2)cc1.Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C23H24O4.C6H7N5/c1-16(24)26-21-12-8-19(9-13-21)23(18-6-4-3-5-7-18)20-10-14-22(15-11-20)27-17(2)25;1-11-3-10-4-5(7)8-2-9-6(4)11/h8-15H,3-7H2,1-2H3;2-3H,1H3,(H2,7,8,9) |
| InChIKey | VXCRILKPEDGNBV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|