C14H13N5O2 — CID 155108832
[4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl] carbamate (PubChem CID 155108832) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is [4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl] carbamate.
| Compound Name | [4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl] carbamate |
|---|---|
| PubChem CID | 155108832 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | [4-(4-amino-7-methylpyrrolo[2,3-d]pyrimidin-5-yl)phenyl] carbamate |
| SMILES | Cn1cc(-c2ccc(OC(N)=O)cc2)c2c(N)ncnc21 |
| InChI | InChI=1S/C14H13N5O2/c1-19-6-10(11-12(15)17-7-18-13(11)19)8-2-4-9(5-3-8)21-14(16)20/h2-7H,1H3,(H2,16,20)(H2,15,17,18) |
| InChIKey | SEVQSTKKUBREBP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |