C12H15N7O2 — CID 139146359
1,5-dimethylpyrimidine-2,4-dione;9-methylpurin-6-amine (PubChem CID 139146359) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1,5-dimethylpyrimidine-2,4-dione;9-methylpurin-6-amine.
| Compound Name | 1,5-dimethylpyrimidine-2,4-dione;9-methylpurin-6-amine |
|---|---|
| PubChem CID | 139146359 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1,5-dimethylpyrimidine-2,4-dione;9-methylpurin-6-amine |
| SMILES | Cc1cn(C)c(=O)[nH]c1=O.Cn1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C6H7N5.C6H8N2O2/c1-11-3-10-4-5(7)8-2-9-6(4)11;1-4-3-8(2)6(10)7-5(4)9/h2-3H,1H3,(H2,7,8,9);3H,1-2H3,(H,7,9,10) |
| InChIKey | TWGVYTNJFAVTCO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 124.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |