C20H25F2N7O6 — CID 159760470
[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methanol;1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 159760470) has the molecular formula C20H25F2N7O6 and a molecular weight of 497.46 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methanol;1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methanol;1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 159760470 |
| Molecular Formula | C20H25F2N7O6 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-fluorooxolan-2-yl]methanol;1-[(2R,4S,5R)-4-fluoro-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@H](CO)O2)c(=O)[nH]c1=O.Nc1ncnc2c1ncn2[C@H]1C[C@H](F)[C@@H](CO)O1 |
| InChI | InChI=1S/C10H12FN5O2.C10H13FN2O4/c11-5-1-7(18-6(5)2-17)16-4-15-8-9(12)13-3-14-10(8)16;1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3-7,17H,1-2H2,(H2,12,13,14);3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t5-,6+,7+;6-,7+,8+/m00/s1 |
| InChIKey | NEUSMDQGXMGNKF-QEYXXENCSA-N |
| XLogP | -0.51 |
| TPSA | 183.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |