C34H43N6O9P — CID 57381982
2-[2-(6-aminopurin-9-yl)ethoxymethyl-[3-[2-(4-benzoylphenyl)propanoyloxy]propoxy]phosphoryl]oxyethyl (2S)-2-amino-3-methylbutanoate (PubChem CID 57381982) has the molecular formula C34H43N6O9P and a molecular weight of 710.73 g/mol. Its IUPAC name is 2-[2-(6-aminopurin-9-yl)ethoxymethyl-[3-[2-(4-benzoylphenyl)propanoyloxy]propoxy]phosphoryl]oxyethyl (2S)-2-amino-3-methylbutanoate.
| Compound Name | 2-[2-(6-aminopurin-9-yl)ethoxymethyl-[3-[2-(4-benzoylphenyl)propanoyloxy]propoxy]phosphoryl]oxyethyl (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 57381982 |
| Molecular Formula | C34H43N6O9P |
| Molecular Weight | 710.73 g/mol |
| Exact Mass | 710.28 |
| IUPAC Name | 2-[2-(6-aminopurin-9-yl)ethoxymethyl-[3-[2-(4-benzoylphenyl)propanoyloxy]propoxy]phosphoryl]oxyethyl (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C(=O)OCCCOP(=O)(COCCn1cnc2c(N)ncnc21)OCCOC(=O)[C@@H](N)C(C)C)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H43N6O9P/c1-23(2)28(35)34(43)47-18-19-49-50(44,22-45-17-14-40-21-39-29-31(36)37-20-38-32(29)40)48-16-7-15-46-33(42)24(3)25-10-12-27(13-11-25)30(41)26-8-5-4-6-9-26/h4-6,8-13,20-21,23-24,28H,7,14-19,22,35H2,1-3H3,(H2,36,37,38)/t24?,28-,50?/m0/s1 |
| InChIKey | BUFARYSTNNKOKV-NJAVRPRJSA-N |
| XLogP | 4.10 |
| TPSA | 210.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|