C35H46FN6O7PS — CID 71593352
3-[3-[(2R)-2-amino-3-methylpentanoyl]sulfanylpropoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate (PubChem CID 71593352) has the molecular formula C35H46FN6O7PS and a molecular weight of 744.83 g/mol. Its IUPAC name is 3-[3-[(2R)-2-amino-3-methylpentanoyl]sulfanylpropoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate.
| Compound Name | 3-[3-[(2R)-2-amino-3-methylpentanoyl]sulfanylpropoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 71593352 |
| Molecular Formula | C35H46FN6O7PS |
| Molecular Weight | 744.83 g/mol |
| Exact Mass | 744.29 |
| IUPAC Name | 3-[3-[(2R)-2-amino-3-methylpentanoyl]sulfanylpropoxy-[2-(6-aminopurin-9-yl)ethoxymethyl]phosphoryl]oxypropyl 2-(3-fluoro-4-phenylphenyl)propanoate |
| SMILES | CCC(C)[C@@H](N)C(=O)SCCCOP(=O)(COCCn1cnc2c(N)ncnc21)OCCCOC(=O)C(C)c1ccc(-c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C35H46FN6O7PS/c1-4-24(2)30(37)35(44)51-19-9-17-49-50(45,23-46-18-14-42-22-41-31-32(38)39-21-40-33(31)42)48-16-8-15-47-34(43)25(3)27-12-13-28(29(36)20-27)26-10-6-5-7-11-26/h5-7,10-13,20-22,24-25,30H,4,8-9,14-19,23,37H2,1-3H3,(H2,38,39,40)/t24?,25?,30-,50?/m1/s1 |
| InChIKey | OWLIDSNTELINGK-OXAJHHCNSA-N |
| XLogP | 6.18 |
| TPSA | 183.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.83 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|