C14H13BN4O4 — CID 169006239
[4-[(5-carbamoylimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid (PubChem CID 169006239) has the molecular formula C14H13BN4O4 and a molecular weight of 312.09 g/mol. Its IUPAC name is [4-[(5-carbamoylimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(5-carbamoylimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 169006239 |
| Molecular Formula | C14H13BN4O4 |
| Molecular Weight | 312.09 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [4-[(5-carbamoylimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid |
| SMILES | NC(=O)c1ccc2c(ncn2Cc2ccc(OB(O)O)cc2)n1 |
| InChI | InChI=1S/C14H13BN4O4/c16-13(20)11-5-6-12-14(18-11)17-8-19(12)7-9-1-3-10(4-2-9)23-15(21)22/h1-6,8,21-22H,7H2,(H2,16,20) |
| InChIKey | NAUBOCUMFATJEI-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.09 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|