C12H12BN5O4 — CID 169006312
[4-[(2-amino-6-oxo-1H-purin-7-yl)methyl]phenoxy]boronic acid (PubChem CID 169006312) has the molecular formula C12H12BN5O4 and a molecular weight of 301.07 g/mol. Its IUPAC name is [4-[(2-amino-6-oxo-1H-purin-7-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(2-amino-6-oxo-1H-purin-7-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 169006312 |
| Molecular Formula | C12H12BN5O4 |
| Molecular Weight | 301.07 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [4-[(2-amino-6-oxo-1H-purin-7-yl)methyl]phenoxy]boronic acid |
| SMILES | Nc1nc2ncn(Cc3ccc(OB(O)O)cc3)c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H12BN5O4/c14-12-16-10-9(11(19)17-12)18(6-15-10)5-7-1-3-8(4-2-7)22-13(20)21/h1-4,6,20-21H,5H2,(H3,14,16,17,19) |
| InChIKey | APDHBMHUHBLKGE-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.07 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|