C14H11BN4O3 — CID 169006263
[4-[(5-cyanoimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid (PubChem CID 169006263) has the molecular formula C14H11BN4O3 and a molecular weight of 294.08 g/mol. Its IUPAC name is [4-[(5-cyanoimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(5-cyanoimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 169006263 |
| Molecular Formula | C14H11BN4O3 |
| Molecular Weight | 294.08 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | [4-[(5-cyanoimidazo[4,5-b]pyridin-1-yl)methyl]phenoxy]boronic acid |
| SMILES | N#Cc1ccc2c(ncn2Cc2ccc(OB(O)O)cc2)n1 |
| InChI | InChI=1S/C14H11BN4O3/c16-7-11-3-6-13-14(18-11)17-9-19(13)8-10-1-4-12(5-2-10)22-15(20)21/h1-6,9,20-21H,8H2 |
| InChIKey | UGPQHJCSDBKIEF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.08 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|