About [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid
[4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid (PubChem CID 155710950) has the molecular formula C15H12BN3O2
and a molecular weight of 277.09 g/mol. Its IUPAC name is [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid.
Molecular Properties
| Compound Name | [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid |
| PubChem CID | 155710950 |
| Molecular Formula | C15H12BN3O2 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid |
| SMILES | N#Cc1ccc2c(ccn2Cc2ccc(B(O)O)cc2)n1 |
| InChI | InChI=1S/C15H12BN3O2/c17-9-13-5-6-15-14(18-13)7-8-19(15)10-11-1-3-12(4-2-11)16(20)21/h1-8,20-21H,10H2 |
| InChIKey | XQUWUWVLWAWAGZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid?
The IUPAC name of [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid (CID 155710950) is [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid.
What is the SMILES notation for [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid?
The canonical SMILES for [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid is N#Cc1ccc2c(ccn2Cc2ccc(B(O)O)cc2)n1.
What is the InChIKey of [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid?
The InChIKey is XQUWUWVLWAWAGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BN3O2/c17-9-13-5-6-15-14(18-13)7-8-19(15)10-11-1-3-12(4-2-11)16(20)21/h1-8,20-21H,10H2.
What are the key properties of [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid?
[4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid has a molecular weight of 277.09 g/mol, XLogP of 0.64, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(5-cyanopyrrolo[3,2-b]pyridin-1-yl)methyl]phenyl]boronic acid is sourced from PubChem (CID 155710950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).