C15H13BN2O4 — CID 155710935
1-[(4-boronophenyl)methyl]benzimidazole-5-carboxylic acid (PubChem CID 155710935) has the molecular formula C15H13BN2O4 and a molecular weight of 296.09 g/mol. Its IUPAC name is 1-[(4-boronophenyl)methyl]benzimidazole-5-carboxylic acid.
| Compound Name | 1-[(4-boronophenyl)methyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 155710935 |
| Molecular Formula | C15H13BN2O4 |
| Molecular Weight | 296.09 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[(4-boronophenyl)methyl]benzimidazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)ncn2Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C15H13BN2O4/c19-15(20)11-3-6-14-13(7-11)17-9-18(14)8-10-1-4-12(5-2-10)16(21)22/h1-7,9,21-22H,8H2,(H,19,20) |
| InChIKey | MDWXIASZDYEIOF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.09 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|