C23H20ClN3O — CID 74930386
1-[(4-chlorophenyl)methyl]-N-(1-phenylethyl)benzimidazole-5-carboxamide (PubChem CID 74930386) has the molecular formula C23H20ClN3O and a molecular weight of 389.89 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-(1-phenylethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-(1-phenylethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 74930386 |
| Molecular Formula | C23H20ClN3O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-(1-phenylethyl)benzimidazole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)ncn2Cc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O/c1-16(18-5-3-2-4-6-18)26-23(28)19-9-12-22-21(13-19)25-15-27(22)14-17-7-10-20(24)11-8-17/h2-13,15-16H,14H2,1H3,(H,26,28) |
| InChIKey | YCOOWKAZTBTOTQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |