C25H25N3O — CID 90380118
1-[(4-methylphenyl)methyl]-N-[(1S)-1-phenylpropyl]benzimidazole-5-carboxamide (PubChem CID 90380118) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]-N-[(1S)-1-phenylpropyl]benzimidazole-5-carboxamide.
| Compound Name | 1-[(4-methylphenyl)methyl]-N-[(1S)-1-phenylpropyl]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 90380118 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-[(4-methylphenyl)methyl]-N-[(1S)-1-phenylpropyl]benzimidazole-5-carboxamide |
| SMILES | CC[C@H](NC(=O)c1ccc2c(c1)ncn2Cc1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O/c1-3-22(20-7-5-4-6-8-20)27-25(29)21-13-14-24-23(15-21)26-17-28(24)16-19-11-9-18(2)10-12-19/h4-15,17,22H,3,16H2,1-2H3,(H,27,29)/t22-/m0/s1 |
| InChIKey | CKHDZBZZWORMEB-QFIPXVFZSA-N |
| XLogP | 5.27 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |