C35H35N3O3 — CID 118072732
tert-butyl 2-[4-[[5-(1-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoate (PubChem CID 118072732) has the molecular formula C35H35N3O3 and a molecular weight of 545.68 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-(1-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[5-(1-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 118072732 |
| Molecular Formula | C35H35N3O3 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | tert-butyl 2-[4-[[5-(1-phenylpropylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCC(NC(=O)c1ccc2c(c1)ncn2Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H35N3O3/c1-5-30(26-11-7-6-8-12-26)37-33(39)27-19-20-32-31(21-27)36-23-38(32)22-24-15-17-25(18-16-24)28-13-9-10-14-29(28)34(40)41-35(2,3)4/h6-21,23,30H,5,22H2,1-4H3,(H,37,39) |
| InChIKey | WZYHDHYTMOSXKT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |