C27H27N3O3 — CID 71572066
2-[4-[[5-(3-methylbutylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71572066) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[4-[[5-(3-methylbutylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-(3-methylbutylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71572066 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 2-[4-[[5-(3-methylbutylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CC(C)CCNC(=O)c1ccc2c(c1)ncn2Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C27H27N3O3/c1-18(2)13-14-28-26(31)21-11-12-25-24(15-21)29-17-30(25)16-19-7-9-20(10-8-19)22-5-3-4-6-23(22)27(32)33/h3-12,15,17-18H,13-14,16H2,1-2H3,(H,28,31)(H,32,33) |
| InChIKey | OYPHFMPHDDEHJT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |