C28H29N3O3 — CID 71572170
2-[4-[[6-(4-methylpentan-2-ylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71572170) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[4-[[6-(4-methylpentan-2-ylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[6-(4-methylpentan-2-ylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71572170 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[4-[[6-(4-methylpentan-2-ylcarbamoyl)benzimidazol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CC(C)CC(C)NC(=O)c1ccc2ncn(Cc3ccc(-c4ccccc4C(=O)O)cc3)c2c1 |
| InChI | InChI=1S/C28H29N3O3/c1-18(2)14-19(3)30-27(32)22-12-13-25-26(15-22)31(17-29-25)16-20-8-10-21(11-9-20)23-6-4-5-7-24(23)28(33)34/h4-13,15,17-19H,14,16H2,1-3H3,(H,30,32)(H,33,34) |
| InChIKey | HUJIUTCHNXQZGA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |