C36H36N2O3 — CID 71074414
tert-butyl 3-[2-[[5-(1-phenylpropylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate (PubChem CID 71074414) has the molecular formula C36H36N2O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is tert-butyl 3-[2-[[5-(1-phenylpropylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 3-[2-[[5-(1-phenylpropylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 71074414 |
| Molecular Formula | C36H36N2O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | tert-butyl 3-[2-[[5-(1-phenylpropylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCC(NC(=O)c1ccc2c(ccn2Cc2ccccc2-c2cccc(C(=O)OC(C)(C)C)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C36H36N2O3/c1-5-32(25-12-7-6-8-13-25)37-34(39)28-18-19-33-27(23-28)20-21-38(33)24-30-14-9-10-17-31(30)26-15-11-16-29(22-26)35(40)41-36(2,3)4/h6-23,32H,5,24H2,1-4H3,(H,37,39) |
| InChIKey | GWRLCMWYWVGNNZ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |