C28H24N2O3S — CID 71075876
1-naphthalen-1-ylsulfonyl-N-(1-phenylpropyl)indole-5-carboxamide (PubChem CID 71075876) has the molecular formula C28H24N2O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is 1-naphthalen-1-ylsulfonyl-N-(1-phenylpropyl)indole-5-carboxamide.
| Compound Name | 1-naphthalen-1-ylsulfonyl-N-(1-phenylpropyl)indole-5-carboxamide |
|---|---|
| PubChem CID | 71075876 |
| Molecular Formula | C28H24N2O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 1-naphthalen-1-ylsulfonyl-N-(1-phenylpropyl)indole-5-carboxamide |
| SMILES | CCC(NC(=O)c1ccc2c(ccn2S(=O)(=O)c2cccc3ccccc23)c1)c1ccccc1 |
| InChI | InChI=1S/C28H24N2O3S/c1-2-25(21-10-4-3-5-11-21)29-28(31)23-15-16-26-22(19-23)17-18-30(26)34(32,33)27-14-8-12-20-9-6-7-13-24(20)27/h3-19,25H,2H2,1H3,(H,29,31) |
| InChIKey | SEVOIRSEDVSYGP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |