C14H13BN2O4 — CID 169006289
[4-[(5-oxo-4H-pyrrolo[3,2-b]pyridin-1-yl)methyl]phenoxy]boronic acid (PubChem CID 169006289) has the molecular formula C14H13BN2O4 and a molecular weight of 284.08 g/mol. Its IUPAC name is [4-[(5-oxo-4H-pyrrolo[3,2-b]pyridin-1-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(5-oxo-4H-pyrrolo[3,2-b]pyridin-1-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 169006289 |
| Molecular Formula | C14H13BN2O4 |
| Molecular Weight | 284.08 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | [4-[(5-oxo-4H-pyrrolo[3,2-b]pyridin-1-yl)methyl]phenoxy]boronic acid |
| SMILES | O=c1ccc2c(ccn2Cc2ccc(OB(O)O)cc2)[nH]1 |
| InChI | InChI=1S/C14H13BN2O4/c18-14-6-5-13-12(16-14)7-8-17(13)9-10-1-3-11(4-2-10)21-15(19)20/h1-8,19-20H,9H2,(H,16,18) |
| InChIKey | BVNNKHKOFRHZCD-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 87.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.08 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|