C16H17BN4O2 — CID 174357988
[4-[(4-amino-5-carbamoylbenzimidazol-1-yl)methyl]phenyl]-methylborinic acid (PubChem CID 174357988) has the molecular formula C16H17BN4O2 and a molecular weight of 308.15 g/mol. Its IUPAC name is [4-[(4-amino-5-carbamoylbenzimidazol-1-yl)methyl]phenyl]-methylborinic acid.
| Compound Name | [4-[(4-amino-5-carbamoylbenzimidazol-1-yl)methyl]phenyl]-methylborinic acid |
|---|---|
| PubChem CID | 174357988 |
| Molecular Formula | C16H17BN4O2 |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-[(4-amino-5-carbamoylbenzimidazol-1-yl)methyl]phenyl]-methylborinic acid |
| SMILES | CB(O)c1ccc(Cn2cnc3c(N)c(C(N)=O)ccc32)cc1 |
| InChI | InChI=1S/C16H17BN4O2/c1-17(23)11-4-2-10(3-5-11)8-21-9-20-15-13(21)7-6-12(14(15)18)16(19)22/h2-7,9,23H,8,18H2,1H3,(H2,19,22) |
| InChIKey | VXDOKBAGBPCVTE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|