C15H11F2N3O — CID 142567283
1-[(3,4-difluorophenyl)methyl]benzimidazole-4-carboxamide (PubChem CID 142567283) has the molecular formula C15H11F2N3O and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]benzimidazole-4-carboxamide.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 142567283 |
| Molecular Formula | C15H11F2N3O |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]benzimidazole-4-carboxamide |
| SMILES | NC(=O)c1cccc2c1ncn2Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H11F2N3O/c16-11-5-4-9(6-12(11)17)7-20-8-19-14-10(15(18)21)2-1-3-13(14)20/h1-6,8H,7H2,(H2,18,21) |
| InChIKey | BMMXFPFSLLCNSU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |