C21H22ClN5O3 — CID 51003214
9-[(3aR,6S,6aS)-5-chloro-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]purin-6-amine (PubChem CID 51003214) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is 9-[(3aR,6S,6aS)-5-chloro-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]purin-6-amine.
| Compound Name | 9-[(3aR,6S,6aS)-5-chloro-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]purin-6-amine |
|---|---|
| PubChem CID | 51003214 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 9-[(3aR,6S,6aS)-5-chloro-2,2-dimethyl-4-(phenylmethoxymethyl)-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]purin-6-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(COCc1ccccc1)=C(Cl)[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C21H22ClN5O3/c1-21(2)29-17-13(9-28-8-12-6-4-3-5-7-12)14(22)16(18(17)30-21)27-11-26-15-19(23)24-10-25-20(15)27/h3-7,10-11,16-18H,8-9H2,1-2H3,(H2,23,24,25)/t16-,17-,18+/m1/s1 |
| InChIKey | QKADFGSXNLYMDU-KURKYZTESA-N |
| XLogP | 3.19 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |