C33H33FN4O5 — CID 155075081
(3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol (PubChem CID 155075081) has the molecular formula C33H33FN4O5 and a molecular weight of 584.65 g/mol. Its IUPAC name is (3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol.
| Compound Name | (3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 155075081 |
| Molecular Formula | C33H33FN4O5 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.24 |
| IUPAC Name | (3R,4S,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-(fluoromethyl)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol |
| SMILES | Nc1ncnn2c(C3(O)O[C@](CF)(COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C33H33FN4O5/c34-21-32(22-40-18-24-10-4-1-5-11-24)29(41-19-25-12-6-2-7-13-25)30(42-20-26-14-8-3-9-15-26)33(39,43-32)28-17-16-27-31(35)36-23-37-38(27)28/h1-17,23,29-30,39H,18-22H2,(H2,35,36,37)/t29-,30+,32+,33?/m0/s1 |
| InChIKey | QZOSYGJDBIXWSE-KCUYHFSPSA-N |
| XLogP | 4.58 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |