C40H40N4O5 — CID 166038451
7-[(2S,3S,4S)-3,4-bis(phenylmethoxy)-5,5-bis(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 166038451) has the molecular formula C40H40N4O5 and a molecular weight of 656.78 g/mol. Its IUPAC name is 7-[(2S,3S,4S)-3,4-bis(phenylmethoxy)-5,5-bis(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 7-[(2S,3S,4S)-3,4-bis(phenylmethoxy)-5,5-bis(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 166038451 |
| Molecular Formula | C40H40N4O5 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.30 |
| IUPAC Name | 7-[(2S,3S,4S)-3,4-bis(phenylmethoxy)-5,5-bis(phenylmethoxymethyl)oxolan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | Nc1ncnn2c([C@@H]3OC(COCc4ccccc4)(COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3OCc3ccccc3)ccc12 |
| InChI | InChI=1S/C40H40N4O5/c41-39-35-22-21-34(44(35)43-29-42-39)36-37(47-25-32-17-9-3-10-18-32)38(48-26-33-19-11-4-12-20-33)40(49-36,27-45-23-30-13-5-1-6-14-30)28-46-24-31-15-7-2-8-16-31/h1-22,29,36-38H,23-28H2,(H2,41,42,43)/t36-,37-,38-/m0/s1 |
| InChIKey | WYOFVZRPQUYKJU-QXUSSCGESA-N |
| XLogP | 6.73 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |