C13H19N5O10P2 — CID 138525668
[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 138525668) has the molecular formula C13H19N5O10P2 and a molecular weight of 467.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138525668 |
| Molecular Formula | C13H19N5O10P2 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.06 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | C/N=C/[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19N5O10P2/c1-15-5-13(9-3-2-7-12(14)16-6-17-18(7)9)11(20)10(19)8(27-13)4-26-30(24,25)28-29(21,22)23/h2-3,5-6,8,10-11,19-20H,4H2,1H3,(H,24,25)(H2,14,16,17)(H2,21,22,23)/b15-5+/t8-,10-,11-,13+/m1/s1 |
| InChIKey | VEVMQJVHQQFEPN-CZSULZCMSA-N |
| XLogP | -1.45 |
| TPSA | 231.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|