C16H23N6O8P — CID 166808506
(2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid (PubChem CID 166808506) has the molecular formula C16H23N6O8P and a molecular weight of 458.37 g/mol. Its IUPAC name is (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid.
| Compound Name | (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid |
|---|---|
| PubChem CID | 166808506 |
| Molecular Formula | C16H23N6O8P |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (2S)-2-[[[(2R,3S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methoxy-hydroxyphosphoryl]amino]propanoic acid |
| SMILES | C=NC[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COP(=O)(O)N[C@@H](C)C(=O)O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H23N6O8P/c1-8(15(25)26)21-31(27,28)29-5-10-12(23)13(24)16(30-10,6-18-2)11-4-3-9-14(17)19-7-20-22(9)11/h3-4,7-8,10,12-13,23-24H,2,5-6H2,1H3,(H,25,26)(H2,17,19,20)(H2,21,27,28)/t8-,10+,12+,13+,16-/m0/s1 |
| InChIKey | VGBIRUFFKVLCEN-PHVBXJGCSA-N |
| XLogP | -1.49 |
| TPSA | 214.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|