C22H29N6O9P — CID 174116991
[(2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methyl [(2R)-3-hydroxy-2-(pyridin-3-ylmethoxy)propyl] hydrogen phosphate (PubChem CID 174116991) has the molecular formula C22H29N6O9P and a molecular weight of 552.48 g/mol. Its IUPAC name is [(2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methyl [(2R)-3-hydroxy-2-(pyridin-3-ylmethoxy)propyl] hydrogen phosphate.
| Compound Name | [(2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methyl [(2R)-3-hydroxy-2-(pyridin-3-ylmethoxy)propyl] hydrogen phosphate |
|---|---|
| PubChem CID | 174116991 |
| Molecular Formula | C22H29N6O9P |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [(2R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-[(methylideneamino)methyl]oxolan-2-yl]methyl [(2R)-3-hydroxy-2-(pyridin-3-ylmethoxy)propyl] hydrogen phosphate |
| SMILES | C=NC[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COP(=O)(O)OC[C@@H](CO)OCc2cccnc2)C(O)C1O |
| InChI | InChI=1S/C22H29N6O9P/c1-24-12-22(18-5-4-16-21(23)26-13-27-28(16)18)20(31)19(30)17(37-22)11-36-38(32,33)35-10-15(8-29)34-9-14-3-2-6-25-7-14/h2-7,13,15,17,19-20,29-31H,1,8-12H2,(H,32,33)(H2,23,26,27)/t15-,17-,19?,20?,22+/m1/s1 |
| InChIKey | MXFXSHMMLDBJPK-LYAULNLVSA-N |
| XLogP | -0.57 |
| TPSA | 216.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|