C24H29FN5O9P — CID 174116900
[(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-[(3-fluoro-4-methoxyphenyl)methoxy]butyl] hydrogen phosphate (PubChem CID 174116900) has the molecular formula C24H29FN5O9P and a molecular weight of 581.49 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-[(3-fluoro-4-methoxyphenyl)methoxy]butyl] hydrogen phosphate.
| Compound Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-[(3-fluoro-4-methoxyphenyl)methoxy]butyl] hydrogen phosphate |
|---|---|
| PubChem CID | 174116900 |
| Molecular Formula | C24H29FN5O9P |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | [(2R,4S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-3,4-dihydroxyoxolan-2-yl]methyl [(2R)-2-[(3-fluoro-4-methoxyphenyl)methoxy]butyl] hydrogen phosphate |
| SMILES | CC[C@H](COP(=O)(O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@@H](O)C1O)OCc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C24H29FN5O9P/c1-3-15(36-9-14-4-6-18(35-2)16(25)8-14)10-37-40(33,34)38-11-19-21(31)22(32)24(12-26,39-19)20-7-5-17-23(27)28-13-29-30(17)20/h4-8,13,15,19,21-22,31-32H,3,9-11H2,1-2H3,(H,33,34)(H2,27,28,29)/t15-,19-,21?,22+,24+/m1/s1 |
| InChIKey | AVJBEPNLWFVNIH-XDEARJHVSA-N |
| XLogP | 1.43 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|