C24H31N6O8P — CID 154953336
ethyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 154953336) has the molecular formula C24H31N6O8P and a molecular weight of 562.52 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 154953336 |
| Molecular Formula | C24H31N6O8P |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | ethyl (2S)-2-[[[(3S,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-5-(methyliminomethyl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OCC1O[C@@](/C=N/C)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C24H31N6O8P/c1-4-35-23(33)15(2)29-39(34,38-16-8-6-5-7-9-16)36-12-18-20(31)21(32)24(37-18,13-26-3)19-11-10-17-22(25)27-14-28-30(17)19/h5-11,13-15,18,20-21,31-32H,4,12H2,1-3H3,(H,29,34)(H2,25,27,28)/b26-13+/t15-,18?,20+,21+,24-,39?/m0/s1 |
| InChIKey | YZRQYKVEFNRFJD-KRGOTFTNSA-N |
| XLogP | 1.07 |
| TPSA | 192.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|