C24H31ClN5O8P — CID 163574464
ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 163574464) has the molecular formula C24H31ClN5O8P and a molecular weight of 583.97 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163574464 |
| Molecular Formula | C24H31ClN5O8P |
| Molecular Weight | 583.97 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxy-4,5-dimethyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)N[P@@](=O)(OC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@](C)(O)[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H31ClN5O8P/c1-5-35-22(32)14(2)29-39(34,38-16-8-6-15(25)7-9-16)36-12-18-20(31)23(3,33)24(4,37-18)19-11-10-17-21(26)27-13-28-30(17)19/h6-11,13-14,18,20,31,33H,5,12H2,1-4H3,(H,29,34)(H2,26,27,28)/t14-,18+,20+,23+,24-,39+/m0/s1 |
| InChIKey | GCFXLVQDGUPLRT-YHPBQWQASA-N |
| XLogP | 2.44 |
| TPSA | 179.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.97 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|