C22H28ClN6O7P — CID 70960241
ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate (PubChem CID 70960241) has the molecular formula C22H28ClN6O7P and a molecular weight of 554.93 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 70960241 |
| Molecular Formula | C22H28ClN6O7P |
| Molecular Weight | 554.93 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-(4-chlorophenoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](c2cnc3c(N)ncnn23)[C@@H](C)[C@@H]1O)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28ClN6O7P/c1-4-33-22(31)13(3)28-37(32,36-15-7-5-14(23)6-8-15)34-10-17-18(30)12(2)19(35-17)16-9-25-21-20(24)26-11-27-29(16)21/h5-9,11-13,17-19,30H,4,10H2,1-3H3,(H,28,32)(H2,24,26,27)/t12-,13-,17+,18-,19+,37?/m0/s1 |
| InChIKey | BQQSHJQTIMSCHC-LLUDCEQASA-N |
| XLogP | 2.54 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.93 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|