C24H30BrN4O8P — CID 135242415
propan-2-yl (2R)-2-[[[(2R,3S,4R,5S)-5-(5-bromo-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 135242415) has the molecular formula C24H30BrN4O8P and a molecular weight of 613.40 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3S,4R,5S)-5-(5-bromo-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5S)-5-(5-bromo-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 135242415 |
| Molecular Formula | C24H30BrN4O8P |
| Molecular Weight | 613.40 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3S,4R,5S)-5-(5-bromo-4-methylpyrrolo[2,1-f][1,2,4]triazin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | Cc1ncnn2c([C@@H]3O[C@H](COP(=O)(N[C@H](C)C(=O)OC(C)C)Oc4ccccc4)[C@@H](O)[C@H]3O)cc(Br)c12 |
| InChI | InChI=1S/C24H30BrN4O8P/c1-13(2)35-24(32)15(4)28-38(33,37-16-8-6-5-7-9-16)34-11-19-21(30)22(31)23(36-19)18-10-17(25)20-14(3)26-12-27-29(18)20/h5-10,12-13,15,19,21-23,30-31H,11H2,1-4H3,(H,28,33)/t15-,19-,21-,22-,23+,38?/m1/s1 |
| InChIKey | SIGVIRRPFZITAT-HWJHNWQZSA-N |
| XLogP | 3.10 |
| TPSA | 153.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|