C23H31N6O7P — CID 147657817
2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 2-methylpropanoate (PubChem CID 147657817) has the molecular formula C23H31N6O7P and a molecular weight of 534.51 g/mol. Its IUPAC name is 2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 2-methylpropanoate.
| Compound Name | 2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 2-methylpropanoate |
|---|---|
| PubChem CID | 147657817 |
| Molecular Formula | C23H31N6O7P |
| Molecular Weight | 534.51 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 2-[[[(2R,3S,4S,5R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]ethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCNP(=O)(OC[C@H]1O[C@@H](c2cnc3c(N)ncnn23)[C@@H](C)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C23H31N6O7P/c1-14(2)23(31)33-10-9-28-37(32,36-16-7-5-4-6-8-16)34-12-18-19(30)15(3)20(35-18)17-11-25-22-21(24)26-13-27-29(17)22/h4-8,11,13-15,18-20,30H,9-10,12H2,1-3H3,(H,28,32)(H2,24,26,27)/t15-,18+,19-,20+,37?/m0/s1 |
| InChIKey | GKTGXECDVMAELY-CHDDJQSCSA-N |
| XLogP | 2.14 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.51 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|