C26H30FN6O7P — CID 56600551
ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 56600551) has the molecular formula C26H30FN6O7P and a molecular weight of 588.53 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 56600551 |
| Molecular Formula | C26H30FN6O7P |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5S)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](c2cnc3c(N)ncnn23)[C@](C)(F)[C@@H]1O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C26H30FN6O7P/c1-4-37-25(35)15(2)32-41(36,40-19-11-7-9-16-8-5-6-10-17(16)19)38-13-20-21(34)26(3,27)22(39-20)18-12-29-24-23(28)30-14-31-33(18)24/h5-12,14-15,20-22,34H,4,13H2,1-3H3,(H,32,36)(H2,28,30,31)/t15-,20+,21+,22-,26+,41?/m0/s1 |
| InChIKey | OVRMLYNOYDOLIN-JJDNRWPYSA-N |
| XLogP | 3.13 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|