C31H40FN6O7P — CID 122527319
2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate (PubChem CID 122527319) has the molecular formula C31H40FN6O7P and a molecular weight of 658.67 g/mol. Its IUPAC name is 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate.
| Compound Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122527319 |
| Molecular Formula | C31H40FN6O7P |
| Molecular Weight | 658.67 g/mol |
| Exact Mass | 658.27 |
| IUPAC Name | 2,2-dimethylpropyl (2S)-2-[[[(2R,3R,4R,5R)-4-fluoro-3-hydroxy-4-methyl-5-[2-methyl-6-(methylamino)purin-9-yl]oxolan-2-yl]methoxy-naphthalen-1-yloxyphosphoryl]amino]propanoate |
| SMILES | CNc1nc(C)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(N[C@@H](C)C(=O)OCC(C)(C)C)Oc2cccc3ccccc23)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C31H40FN6O7P/c1-18(28(40)42-16-30(3,4)5)37-46(41,45-22-14-10-12-20-11-8-9-13-21(20)22)43-15-23-25(39)31(6,32)29(44-23)38-17-34-24-26(33-7)35-19(2)36-27(24)38/h8-14,17-18,23,25,29,39H,15-16H2,1-7H3,(H,37,41)(H,33,35,36)/t18-,23+,25+,29+,31+,46?/m0/s1 |
| InChIKey | SLRGPRYDEHJIHS-LUUJWMOISA-N |
| XLogP | 5.09 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|