C14H20N5O13P3 — CID 118408638
[[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-3-hydroxy-5-methoxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118408638) has the molecular formula C14H20N5O13P3 and a molecular weight of 559.26 g/mol. Its IUPAC name is [[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-3-hydroxy-5-methoxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-3-hydroxy-5-methoxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118408638 |
| Molecular Formula | C14H20N5O13P3 |
| Molecular Weight | 559.26 g/mol |
| Exact Mass | 559.03 |
| IUPAC Name | [[(2R,3S,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-cyano-3-hydroxy-5-methoxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CO[C@@]1(c2ccc3c(N)ncnn23)O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)C1(C)C#N |
| InChI | InChI=1S/C14H20N5O13P3/c1-13(6-15)11(20)9(5-29-34(24,25)32-35(26,27)31-33(21,22)23)30-14(13,28-2)10-4-3-8-12(16)17-7-18-19(8)10/h3-4,7,9,11,20H,5H2,1-2H3,(H,24,25)(H,26,27)(H2,16,17,18)(H2,21,22,23)/t9-,11-,13?,14+/m1/s1 |
| InChIKey | SFUFZFGZNMYWEU-SUFHQJMPSA-N |
| XLogP | -0.26 |
| TPSA | 278.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|