C15H24N5O12P3 — CID 123986580
[[5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-ethenyl-5-methoxy-4,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 123986580) has the molecular formula C15H24N5O12P3 and a molecular weight of 559.30 g/mol. Its IUPAC name is [[5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-ethenyl-5-methoxy-4,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-ethenyl-5-methoxy-4,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 123986580 |
| Molecular Formula | C15H24N5O12P3 |
| Molecular Weight | 559.30 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | [[5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-3-ethenyl-5-methoxy-4,4-dimethyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=CC1C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)OC(OC)(c2cnc3c(N)ncnn23)C1(C)C |
| InChI | InChI=1S/C15H24N5O12P3/c1-5-9-10(7-29-34(24,25)32-35(26,27)31-33(21,22)23)30-15(28-4,14(9,2)3)11-6-17-13-12(16)18-8-19-20(11)13/h5-6,8-10H,1,7H2,2-4H3,(H,24,25)(H,26,27)(H2,16,18,19)(H2,21,22,23) |
| InChIKey | QBLUBULLFIWBRU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 247.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|