C13H18N5O12P3 — CID 118404232
[[(2R,3S,4R,5R)-5-(8-aminoimidazo[1,2-b]pyridazin-3-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118404232) has the molecular formula C13H18N5O12P3 and a molecular weight of 529.23 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(8-aminoimidazo[1,2-b]pyridazin-3-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-5-(8-aminoimidazo[1,2-b]pyridazin-3-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118404232 |
| Molecular Formula | C13H18N5O12P3 |
| Molecular Weight | 529.23 g/mol |
| Exact Mass | 529.02 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(8-aminoimidazo[1,2-b]pyridazin-3-yl)-4-cyano-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(C#N)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1c1cnc2c(N)ccnn12 |
| InChI | InChI=1S/C13H18N5O12P3/c1-13(6-14)10(19)9(5-27-32(23,24)30-33(25,26)29-31(20,21)22)28-11(13)8-4-16-12-7(15)2-3-17-18(8)12/h2-4,9-11,19H,5,15H2,1H3,(H,23,24)(H,25,26)(H2,20,21,22)/t9-,10-,11+,13-/m1/s1 |
| InChIKey | BACNAGYKKTVEKV-HNCHTBHHSA-N |
| XLogP | -0.01 |
| TPSA | 269.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|