C16H23N6O12P3 — CID 118404213
[[(2R,3S,4R,5R)-4-cyano-5-[4-[(Z)-2-(dimethylamino)ethenyl]imidazo[2,1-f][1,2,4]triazin-7-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 118404213) has the molecular formula C16H23N6O12P3 and a molecular weight of 584.31 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-4-cyano-5-[4-[(Z)-2-(dimethylamino)ethenyl]imidazo[2,1-f][1,2,4]triazin-7-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3S,4R,5R)-4-cyano-5-[4-[(Z)-2-(dimethylamino)ethenyl]imidazo[2,1-f][1,2,4]triazin-7-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 118404213 |
| Molecular Formula | C16H23N6O12P3 |
| Molecular Weight | 584.31 g/mol |
| Exact Mass | 584.06 |
| IUPAC Name | [[(2R,3S,4R,5R)-4-cyano-5-[4-[(Z)-2-(dimethylamino)ethenyl]imidazo[2,1-f][1,2,4]triazin-7-yl]-3-hydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CN(C)/C=C\c1ncnn2c([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]3(C)C#N)cnc12 |
| InChI | InChI=1S/C16H23N6O12P3/c1-16(8-17)13(23)12(7-31-36(27,28)34-37(29,30)33-35(24,25)26)32-14(16)11-6-18-15-10(4-5-21(2)3)19-9-20-22(11)15/h4-6,9,12-14,23H,7H2,1-3H3,(H,27,28)(H,29,30)(H2,24,25,26)/b5-4-/t12-,13-,14+,16-/m1/s1 |
| InChIKey | AYZMPFDVOIAZKH-YYSOMPCLSA-N |
| XLogP | 0.33 |
| TPSA | 259.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.31 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|