C12H16N8O4 — CID 118886454
(2R,3S,4R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol (PubChem CID 118886454) has the molecular formula C12H16N8O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is (2R,3S,4R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol.
| Compound Name | (2R,3S,4R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 118886454 |
| Molecular Formula | C12H16N8O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2R,3S,4R)-5-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-azido-2-(hydroxymethyl)-5-methoxy-4-methyloxolan-3-ol |
| SMILES | COC1(c2cnc3c(N)ncnn23)O[C@H](CO)[C@@H](O)[C@@]1(C)N=[N+]=[N-] |
| InChI | InChI=1S/C12H16N8O4/c1-11(18-19-14)8(22)6(4-21)24-12(11,23-2)7-3-15-10-9(13)16-5-17-20(7)10/h3,5-6,8,21-22H,4H2,1-2H3,(H2,13,16,17)/t6-,8-,11-,12?/m1/s1 |
| InChIKey | AIKSIPKFYKFWEP-LJLZEHCFSA-N |
| XLogP | -0.67 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|