C13H17FN4O3 — CID 66828238
[(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-methoxy-4-methyloxolan-2-yl]methanol (PubChem CID 66828238) has the molecular formula C13H17FN4O3 and a molecular weight of 296.30 g/mol. Its IUPAC name is [(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-methoxy-4-methyloxolan-2-yl]methanol.
| Compound Name | [(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-methoxy-4-methyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 66828238 |
| Molecular Formula | C13H17FN4O3 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [(2S,4R,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-5-methoxy-4-methyloxolan-2-yl]methanol |
| SMILES | CO[C@@]1(c2ccc3c(N)ncnn23)O[C@H](CO)C[C@@]1(C)F |
| InChI | InChI=1S/C13H17FN4O3/c1-12(14)5-8(6-19)21-13(12,20-2)10-4-3-9-11(15)16-7-17-18(9)10/h3-4,7-8,19H,5-6H2,1-2H3,(H2,15,16,17)/t8-,12+,13-/m0/s1 |
| InChIKey | GYZDIECZXGZQIL-CKLFPEKLSA-N |
| XLogP | 0.62 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |