C12H14F2N4O4 — CID 167635368
(2S,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(difluoromethyl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 167635368) has the molecular formula C12H14F2N4O4 and a molecular weight of 316.26 g/mol. Its IUPAC name is (2S,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(difluoromethyl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(difluoromethyl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 167635368 |
| Molecular Formula | C12H14F2N4O4 |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (2S,4R,5S)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-(difluoromethyl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnn2c([C@]3(C(F)F)O[C@@H](CO)[C@H](O)C3O)ccc12 |
| InChI | InChI=1S/C12H14F2N4O4/c13-11(14)12(9(21)8(20)6(3-19)22-12)7-2-1-5-10(15)16-4-17-18(5)7/h1-2,4,6,8-9,11,19-21H,3H2,(H2,15,16,17)/t6-,8-,9?,12-/m0/s1 |
| InChIKey | YINLXJCDHAKTFV-HXPSPVIBSA-N |
| XLogP | -1.12 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |