C13H14FN5O3 — CID 122677700
(2S,3R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-methyloxolane-3-carbonitrile (PubChem CID 122677700) has the molecular formula C13H14FN5O3 and a molecular weight of 307.29 g/mol. Its IUPAC name is (2S,3R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-methyloxolane-3-carbonitrile.
| Compound Name | (2S,3R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-methyloxolane-3-carbonitrile |
|---|---|
| PubChem CID | 122677700 |
| Molecular Formula | C13H14FN5O3 |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2S,3R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-2-methyloxolane-3-carbonitrile |
| SMILES | C[C@@]1(c2ccc3c(N)ncnn23)O[C@H](CO)C(O)[C@]1(F)C#N |
| InChI | InChI=1S/C13H14FN5O3/c1-12(13(14,5-15)10(21)8(4-20)22-12)9-3-2-7-11(16)17-6-18-19(7)9/h2-3,6,8,10,20-21H,4H2,1H3,(H2,16,17,18)/t8-,10?,12+,13-/m1/s1 |
| InChIKey | AGKTVBWSXPWPOV-SOPCFEJTSA-N |
| XLogP | -0.49 |
| TPSA | 129.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |