C14H16FN5O3 — CID 122677728
(2S,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(methoxymethyl)-2-methyloxolane-3-carbonitrile (PubChem CID 122677728) has the molecular formula C14H16FN5O3 and a molecular weight of 321.31 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(methoxymethyl)-2-methyloxolane-3-carbonitrile.
| Compound Name | (2S,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(methoxymethyl)-2-methyloxolane-3-carbonitrile |
|---|---|
| PubChem CID | 122677728 |
| Molecular Formula | C14H16FN5O3 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (2S,3R,4R,5R)-2-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-3-fluoro-4-hydroxy-5-(methoxymethyl)-2-methyloxolane-3-carbonitrile |
| SMILES | COC[C@H]1O[C@@](C)(c2ccc3c(N)ncnn23)[C@@](F)(C#N)[C@@H]1O |
| InChI | InChI=1S/C14H16FN5O3/c1-13(10-4-3-8-12(17)18-7-19-20(8)10)14(15,6-16)11(21)9(23-13)5-22-2/h3-4,7,9,11,21H,5H2,1-2H3,(H2,17,18,19)/t9-,11-,13+,14-/m1/s1 |
| InChIKey | POFUQQOGONTTSB-QIRAZROLSA-N |
| XLogP | 0.16 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |