C19H19FN5O6P — CID 51041120
[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate (PubChem CID 51041120) has the molecular formula C19H19FN5O6P and a molecular weight of 463.36 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 51041120 |
| Molecular Formula | C19H19FN5O6P |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-5-cyano-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methyl phenyl hydrogen phosphate |
| SMILES | C[C@@]1(F)[C@H](O)[C@@H](COP(=O)(O)Oc2ccccc2)O[C@@]1(C#N)c1ccc2c(N)ncnn12 |
| InChI | InChI=1S/C19H19FN5O6P/c1-18(20)16(26)14(9-29-32(27,28)31-12-5-3-2-4-6-12)30-19(18,10-21)15-8-7-13-17(22)23-11-24-25(13)15/h2-8,11,14,16,26H,9H2,1H3,(H,27,28)(H2,22,23,24)/t14-,16-,18-,19+/m1/s1 |
| InChIKey | LUILEJOQWRPALC-OPNNQBFTSA-N |
| XLogP | 1.71 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|